Answer:
its becuz the water is not capable to disolve all the salt it has limits and ones it reaches its limit it wont have the ability to disolve any salt
There are 8.421 g of dry ZnSO4 and
6.579 g H₂O in the sample.
Step 2: Determine the moles of water and anhydrous compound.
Zn = 65.38 g/mol, S = 32.07 g/mol,
H = 1.01 g/mol, O = 16.00 g/mol
How many moles of ZnSO4 are present?
[?] mol ZnSO4
The number of moles of H₂O is 0.36 mol.
The number of moles of LiClO₄ is 0.0521 mol.
What are moles?Mole is an important standard unit used for the measurement of large quantities of atoms, molecules, or other particles. One mole is equal to 6.022×10²³ units.
The number of moles of a substance is calculated by:
Moles =[tex]\frac{mass}{molar \;mass}[/tex]
To find the number of moles of H₂O:
Mass of H₂O in the sample = 6.579 g
The molecular weight of H₂O = 18.02g
Moles = [tex]\frac{mass}{molar \;mass}[/tex]
Moles = [tex]\frac{6.579 g}{18.02g}[/tex]
Moles = 0.36
To find the number of moles of [tex]ZnSO_4[/tex]:
Mass of [tex]ZnSO_4[/tex] in the sample = 8.421 g
The molecular weight of [tex]ZnSO_4[/tex]= 161.47 g/mol
Moles =[tex]\frac{mass}{molar \;mass}[/tex]
Moles = [tex]\frac{8.421 g}{161.47 g/mol}[/tex]
Moles = 0.0521 moles
Learn more about moles here:
https://brainly.com/question/8455949
#SPJ1
Please check the photo! I will award brainliest ONLY FOR PERSON WHO GIVES A LEGITIMATE ANSWER!!! Thank you :)
From the calculations, the percentage of the mineral left is 6.25%.
What is half life?The term half life refers to the time that it takes for only half of the number of radioactive isotopes to remain.
From;
N/No = (0.5)^t/t1/2
N = ?
No = ??
t = 2000
t1/2 = 500
N/No =(0.5)^(2000/500)
N/No = 0.0625
Thus the percent left = 0.0625 * 100 = 6.25%
Learn more about half life of a nucleus:https://brainly.com/question/23518766
#SPJ1
Which of the following species of fish have cartilaginous skeletons?
Answer:
sharks have cartilaginous skeletons
Explanation:
Sharks are an example
What would cause a nucleus to be unstable?
A. An unequal number of protons and electrons
B. Too few quarks within the nucleus of the atom
C. An equal number of protons and neutrons
D. An imbalance between the electrostatic and strong nuclear forces
SUBMIT
The instability of the nucleus is due to an imbalance between the electrostatic and strong nuclear forces, which is option D.
A nucleus can become unstable if there is an imbalance between the electrostatic repulsion between protons and the strong nuclear force that holds the nucleus together. The electrostatic repulsion between protons tends to push them apart, while the strong nuclear force acts to hold the protons and neutrons together.
If the number of protons in the nucleus is too large, the electrostatic repulsion becomes stronger, making the nucleus unstable. Similarly, if the number of neutrons is too large or too small compared to the number of protons, it can also lead to an imbalance in the forces and instability of the nucleus.
Therefore, the correct option is option d.
Learn more about the nucleus here:
https://brainly.com/question/11801308
#SPJ 7
Only certified electricians are allowed to work on facility electrical system?
3.the three major types of radioactive decay of an unstable nucleus are alpha particles, beta particles, and gamma rays.
explain how alpha decay works and how it causes a transmutation. be sure to note all changes to the nucleus in your explanation.
write the equation for the alpha decay of uranium-234.
explain how beta decay works and how it causes a transmutation. be sure to include all changes to the nucleus in your explanation.
write the equation for the beta decay of iodine-131.
a) Alpha decay occurs when an unstable nuclide emits an alpha particle, (which is just a helium-4 atom), which contains 2 protons and 4 neutrons. This means that transmutation has occurred (since a nuclide of a different element will be produced), and this newly produced nuclide will have 2 fewer protons and 4 fewer neutrons than the original nuclide.
b) [tex]^{234}_{92} \text{U} \longrightarrow ^{4}_{2} \text{He}+^{230}_{90} \text{Th}[/tex]
c) Alpha decay occurs when an unstable nuclide emits a beta particle, (also known as an electron). This causes transmutation (since a nuclide of a different element will be produced), and this newly produced nuclide will have 1 more proton than the original nuclide.
d) [tex]^{131}_{53} \text{I} \longrightarrow ^{0}_{-1} \beta+^{131}_{54} \text{Xe}[/tex]
Prepare a project report on various samples of
a) a mixture
b) a compound
c) an element ( metal or non metal)
( 2 from each ) highlighting the main characteristics features of elements, compounds and mixtures.
Answer:
please mark me as brain list
Explanation:
Any substance that contains only one kind of an atom is known as an element. Because atoms cannot be created or destroyed in a chemical reaction, elements such as phosphorus (P4) or sulfur (S8) cannot be broken down into simpler substances by these reactions
Example: Water decomposes into a mixture of hydrogen and oxygen, on the other hand, cannot be decomposed into simpler substances. They are therefore the elementary, or simplest, chemical substances elements.
Each element is represented by a unique symbol. The notation for each element can be found on a periodic table of elements.
The elements can be divided into three categories that have characteristics properties: metals, nonmetals and semimetals. Most elements are metals, which are found on the left and toward the bottom of the periodic table. A handful of nonmetals are clustered in the upper right corner of the periodic table. The semimetals can be found along the dividing line between the metals and the nonmetals.
A 5 Complete the sentences using words from the list. You may use them once, more than once, or not at all.
increases；decreases；stays the same
a) When liquid water boils, the distance between the particles ____
b) When liquid water boils, the strength of the attractive forces between the particles ___
c) When steam condenses, the speed of movement of the particles ___
Answer
Number 1. increase
number 2 . decrease
number 3. decrease
Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermic
reaction ?
O The fireworks produce colors.
O The fireworks give off heat.
O Igniting the fireworks requires energy.
O Igniting the fireworks makes an odor.
The best explanation for why a firework being ignited is an example of an exothermic reaction and not an endothermic reaction is:
The fireworks give off heat.
Heat is emitted into the environment in an exothermic reaction. When a firework is lit, it undergoes a number of chemical processes inside the firework combination, which produces gases and produces a great deal of heat. Fireworks' distinctive visual display and audible effects are produced when heat is released as light and sound.
In contrast, heat is taken from the environment during an endothermic reaction. If a reaction were endothermic, it would need an outside energy source to continue, and because it would be absorbing heat from its environment, it would feel chilly to the touch.
However, because they release heat and energy and brighten the night sky, fireworks are instances of exothermic reactions.
To know more about heat:
https://brainly.com/question/32136211
#SPJ2
What conditions make AG always positive?
Answer: when a reaction absorbs heat or decreases the entropy of the system,
Explanation: :)
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please
Answer:
1-bromo-6-chloro-5-methylheptane
Explanation:
There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.
The longest carbon chain consists of 7 carbons.
There are no double bonds, based on the saturation and substituents.
So you have a 1-bromo-6-chloro-5-methylheptane.
Hope that was the brainliest answer!
Which phrase describes a homogeneous catalyst?
Answer:
It is in the same phase as the reactants.
Explanation:
i took the test
A 35. 0-l steel tank at 20. 0?c contains acetylene gas, c2h2, at a pressure of 1. 39 atm. Assuming ideal behavior, how many grams of acetylene are in the tank?.
52.66 grams of acetylene are in the tank.
PV=nRT is the formula for ideal gases, where P is the pressure and R is the constant and T is the temperature (P is 1.39 atm in this case)
Volume = 35.0 L
Gas constant = 0.08206 L.atm/K.mole
Temperature = 20.0 °C = 293 °C
We also know that we can apply the formula ;
Number of mole(n) = [tex]\frac{MmPV}{RT}[/tex]
m = ( 26.04 × 1.39 × 35 )/ (0.08206 × 293.15)
m = 52.66 g
Thus, the mass is 52.66 grams.
Learn more about ideal gases here:
https://brainly.com/question/12281987
#SPJ4
what can we use to help us predict the results of reaction when we put metals into competition?
The activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.
What is used in comparing reactivity of metals?The reactivity of metals can be compared using their electrode potentials which is a measures of the ability of the metal to donate electrons to another metal.
When comparing the reactivity of metals, the metal with the lesser negative electrode potential will be more reactive than another with a greater negative or positive electrode potential.
Therefore, the activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.
Learn more about activity series of metals at: https://brainly.com/question/17469010
#SPJ12
An educated guess which explains observations is called:
a a law
b an experiment
c a hypothesis
d a variable
Answer:
c. a hypothesis is the correct answer
Explanation:
Which type of electromagnetic wave has less energy than a microwave?
OA. Ultraviolet wave
OB. Radio wave
O C. An X-ray
OD. Infrared wave
The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab. How many moles of dextrose is this equivalent to?
The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab the moles of dextrose is this equivalent to is 3.6888 moles.
What are moles?A mole is described as 6.02214076 × 1023 of a few chemical unit, be it atoms, molecules, ions, or others. The mole is a handy unit to apply due to the tremendous variety of atoms, molecules, or others in any substance.
To calculate molar equivalents for every reagent, divide the moles of that reagent through the moles of the restricting reagent. The calculation is follows:
655/12 x 6 + 12+ 16 x 6 = 655/ 180 = 3.6888 moles.Read more about moles:
https://brainly.com/question/24322641
#SPJ1
Grams in 1.083e+24
Molecules Na BR
Please help explain why
Answer:
185 gms o NaBr
Explanation:
Na Br mole weight = 22.989 +79.904 = 102.893 gm/mole
1.083 x 10^24 molecules / 6.022 x 10^23 molecules / mole = 1.798 moles
102.893 * 1.798 = 185 gms
The Cabbage Indicator
Your hypothesis about how to indicate various levels of pH, both acid and base with an indicator:
What liquids were used in the investigation?
Vinegar is an acid. Which liquids produced colors like vinegar?
Baking soda is a base. Which liquids produced colors like baking soda?
Did you see any that did not fit into either color group? If so which one(s)?
Could you determine the relative pH of the liquids by the varying color of the cabbage indicator?
Do you think you could add drops of a base solution into an acid solution until they indicate neutral?
How would you be able to tell when a neutral pH was obtained?
What did you find out from this investigation? Be thoughtful in your answer.
.A solution that serves as a pH indicator may be made using red cabbage, which is frequently available in homes. In essence, the color of the cabbage depends on the acidity of the solution and a pigment molecule called flavin or anthocyanin.
To determine whether a material is an acid or a base, red cabbage indicator is a purple-colored solution
Vinegar is an acid and its pH value is less than 7 and hence
Red color is produced
Baking soda is base and its pH value is greater than 7 and between 8-9
and the color produced is sky blue
Bleach is the green which is also a basic and because the pH value is 10-11
Householder cleaner is having pH 11-13 which is basic and hence the yellow is the color of household cleaner .
A basic solution goes away from being basic and toward the center of the pH scale when an acid is introduced. The base is "neutralized" in this manner.
Learn more about pH value here
https://brainly.com/question/19584961
#SPJ10
2 NH3 + 3 CuO →3 Cu + N₂ + 3 H₂O
In the above equation, how many grams of N₂ can be made when 4.3 moles of CuO are consumed?
Round your answer to the nearest tenth. If you answer is a whole number like 4, report the answer
as 4.0
Use the following molar masses. If you do not use these masses, the computer will mark your
answer incorrect.:
Element Molar Mass
Hydrogen 1
Nitrogen 14
Copper 63.5
Oxygen 16
40.1g of nitrogen gas is produced.
The equation given is
2 NH₃ + 3 CuO →3 Cu + N₂ + 3 H₂O
This equation is already balanced.
When 3 moles of CuO are consumed, 1 mole of nitrogen gas is produced.
We get 1 mole of nitrogen from 3 moles of copper oxide.
We need to find the number of moles of nitrogen gas produced when 4.3 moles of copper oxide are consumed.
4.3/3 x 1 = 1.433 mols
1.433 mols of nitrogen gas are producedThe molar mass of nitrogen gas is 14+14 = 28gThe amount of nitrogen gas produced in grams is 28x1.433 = 40.1g40.1g of nitrogen gas can be made when 4.3 moles of CuO are consumed.
Learn more about molarity here:
https://brainly.com/question/24305514
#SPJ10
A 2. 75-l container filled with co2 gas at 25°c and 225 kpa pressure springs a leak. When the container is re-sealed, the pressure is 185 kpa and the temperature is 10°c. How many moles of gas were lost?.
Answer:
Moles Lost = 0.0335 moles
Explanation:
This type of question requires the Ideal Gas Law equation. The equation looks like this:
PV = nRT
In this formula,
-----> P = pressure (kPa)
-----> V = volume (L)
-----> n = number of moles
-----> R = constant (8.314 L*kPa/mol*K)
-----> T = temperature (K)
(Step 1)
To find how many moles were lost, you first need to find how many moles you had to begin with. This can be done by plugging the starting values into the equation and solving for "n". But first, you need to convert Celsius to Kelvin (by adding 273.15).
P = 225 kPa R = 8.314 L*kPa/mol*K
V = 2.75 L T = 25°C + 273.15 = 298.15 K
n = ?
PV = nRT
(225 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(298.15 K)
618.75 = n(2478.8191)
0.250 = n
(Step 2)
Next, you need to find the number of moles in the container after it has been re-sealed. The volume is the same because the container did not change. The process should be the same as above.
P = 185 kPa R = 8.314 L*kPa/mol*K
V = 2.75 L T = 10°C + 273.15 = 283.15 K
n = ?
PV = nRT
(185 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(283.15 K)
508.75 = n(2354.1091)
0.216 = n
(Step 3)
Finally, you can find the number of moles lost by subtracting the final amount of moles from the original amount. When doing this calculation, I used the value of the moles saved in my calculator (with more decimal places) to get a more accurate number.
Moles Lost = Initial Moles - Final Moles
Moles Lost = 0.250 moles - 0.216 moles
Moles Lost = 0.0335 moles
hydrochloride acid +_________ zinc chloride +hydrogen
Answer:
Hydrochloride acid + Zinc = Zinc Chloride + Hydrogen
Explanation:
When Hydrochloride acid and Zinc react, it results in the formation of Zinc chloride and hydrogen.
Hope I helped
lighting is more likely to strike a metal tower than a rubber hose because:
A. metal is a conductor and rubber is an insulator
B. the light from the tower attracts the electrons
C. the tower is negatively charged and will accept electrons
D. metal is an insulator and subnet is a conductor
How many grams of
diphosphorus trioxide, P2O3, are
required to produce 10.2 moles of
phosphorous acid, H3PO3?
P2O3 + 3H₂O → 2H3PO3
[?] g P₂O3
From the equation, we know that for every 2 moles of phosphorous acid produced, 1 mole of diphosphorus trioxide is consumed.
This means that we need to find the mass of 10.2/2 = 5.1 moles of diphosphorus trioxide.
The atomic mass of phosphorous is 30.973761998 g/mol.The atomic mass of oxygen is 15.9994 g/mol.So, the formula mass of diphosphorus trioxide is:
2(30.973761998)+3(15.9994)=109.945723996 g/mol.Thus, 5.1 moles have a mass of:
5.1(109.945723996), which is about 561 g (to 3 sf)Answer: 561 g
Explanation:
How can you use quantitative chemistry and reaction dynamics to explain and optimize industrial processes and reactions that happen in everyday life?
The quantitative chemistry is helps in measuring the quantity of chemicals or chemical agents of food while making some dish or cleaning agent. It also helps in determining the quantity of macromolecules in the body, like protein, lipid, etc.
What is quantitative chemistry?
Quantitative chemistry is a branch which tells the quantity of substances, chemicals. The mass, volume etc. It also helps in determining the molecules and toxic level in the body.
Thus, the quantitative chemistry is helps in measuring the quantity of chemicals or chemical agents of food while making some dish or cleaning agent. It also helps in determining the quantity of macromolecules in the body, like protein, lipid, etc.
Learn more about quantitative chemistry
https://brainly.com/question/4544662
#SPJ1
What kind of air mass will bring cold, dry weather as it moves toward an area
Answer:
i think the answer is Continental polar air masses
Explanation:
In 2007, the population of Canada was 1.26 × 108, the population of Mexico was 10.6 × 107, the population of Brazil was 13.6 × 107, and the population of China was 1.86 × 109. Which two countries have the highest population?
A. Canada and China
B. Mexico and China
C. China and Brazil
D. Brazil and Mexico
What is the mass in grams of 4.85 x 10^22 Al atoms? (Report your answer to two places past the decimal
Answer:
2.17 gm Al
Explanation:
First, find the number of moles . Then multiply by the mole weight of aluminum.
# moles = 4.85 x 10^22 / 6.022 x 10^23 = .08053 moles
.0805 moles * 26.981 gm/mole = 2.173 gm
How can i calculate the concentration of 2.357g of sodium chloride in 75ml solution
Answer:
See below
Explanation:
Simply : 2.357 g / 75 ml = .03142 gm/ml or 31.42 gm / liter
A 126.1-gram block of granite at 92.6°c is dropped into a tub of water at 24.7°c in an isolated system. the final temperature of both the granite and the water is 51.9°c. the specific heat capacity of granite is 0.795 joules/gram degree celsius, and the specific heat capacity of water is 4.186 joules/gram degree celsius. the granite block transferred of energy, and the mass of the water is .
The granite block transferred 4,080 joules of energy, and the mass of the water is 35.8 grams.
How we calculate heat transfer of any system ?Heat transfer in any system can be calculated as follow:
q = mCΔT
Given ;
m = mass of granite = 126.1 g C = specific heat of granite = 0.795 joules/gram degree CelsiusΔT = change in temperature of granite = 51.9 °C - 92.6 °C = -40.7 °CPutting all the values in folowing equation,
q = mCΔT
we get
q = 126.1 × 0.795 × -40.7 = -4080 J
Now by using same formula, we can also calculate the mass of water in the following way:
m = q / CΔT
where
C = specific heat of water = 4.186 joules/gram degree Celsius ΔT = change in temperature of water = 51.9 °C – 24.7 °C = 27.2 °CPutting all these values ;
m = -4080 / 4.186 × 27.2 = 35.8 g.
Hence, 4,080 joules of energy is transferred by granite block and 35.8 g is the mass of water.
To learn more about heat transfer here ;
brainly.com/question/18980657
#SPJ1