Answer:
C
Explanation:
The higher the period the higher the activity of an element, therefore, since iodine is in period 6 and bromine is in period 5, the described reaction is not possible due to the fact that bromine is less active
How can i calculate the concentration of 2.357g of sodium chloride in 75ml solution
Answer:
See below
Explanation:
Simply : 2.357 g / 75 ml = .03142 gm/ml or 31.42 gm / liter
what can we use to help us predict the results of reaction when we put metals into competition?
The activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.
What is used in comparing reactivity of metals?The reactivity of metals can be compared using their electrode potentials which is a measures of the ability of the metal to donate electrons to another metal.
When comparing the reactivity of metals, the metal with the lesser negative electrode potential will be more reactive than another with a greater negative or positive electrode potential.
Therefore, the activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.
Learn more about activity series of metals at: https://brainly.com/question/17469010
#SPJ12
Grams in 1.083e+24
Molecules Na BR
Please help explain why
Answer:
185 gms o NaBr
Explanation:
Na Br mole weight = 22.989 +79.904 = 102.893 gm/mole
1.083 x 10^24 molecules / 6.022 x 10^23 molecules / mole = 1.798 moles
102.893 * 1.798 = 185 gms
In 2007, the population of Canada was 1.26 × 108, the population of Mexico was 10.6 × 107, the population of Brazil was 13.6 × 107, and the population of China was 1.86 × 109. Which two countries have the highest population?
A. Canada and China
B. Mexico and China
C. China and Brazil
D. Brazil and Mexico
The cutoff frequency for a certain element is 1.22 x 1015 Hz. What is its work function in eV?
Hint: 1 eV 1.60 x 10-19 J
=[?] eV
someone please teach me how to solve this its gonna make me cry
The work function of the metal is obtained as 5.1 eV
What is the cutoff frequency?The cutoff frequency is the frequency below which photo electric effect can not occur as electrons are not removed from the metal surface.
Now;
fo = 1.22 x 10^15 Hz
Wo = hfo
Wo = 6.6 * 10^-34 * 1.22 x 10^15
Wo = 8.1 * 10^-19 J
If 1 eV = 1.60 x 10-19 J
x eV = 8.1 * 10^-19 J
x = 8.1 * 10^-19/ 1.60 x 10-19
x = 5.1 eV
Learn more about cutoff frequency:https://brainly.com/question/14378802
#SPJ1
How many atoms are present in 2.1 moles of Fe
Answer:
1.3 x 10²⁴ atoms Fe
Explanation:
To convert moles to atoms, you need to multiply your given value by Avogadro's Number. This causes the conversion to occur because Avogadro's Number exists as a ratio. It is the ratio that allows for the cancellation of units during multiplication. This is why atoms should be in the numerator of your conversion. The final answer should have 2 sig figs to reflect the given value.
Avogadro's Number:
1 mole = 6.022 x 10²³ atoms
2.1 moles Fe 6.022 x 10²³ atoms
--------------------- x ------------------------------- = 1.3 x 10²⁴ atoms Fe
1 mole
Only certified electricians are allowed to work on facility electrical system?
Please check the photo! I will award brainliest ONLY FOR PERSON WHO GIVES A LEGITIMATE ANSWER!!! Thank you :)
From the calculations, the percentage of the mineral left is 6.25%.
What is half life?The term half life refers to the time that it takes for only half of the number of radioactive isotopes to remain.
From;
N/No = (0.5)^t/t1/2
N = ?
No = ??
t = 2000
t1/2 = 500
N/No =(0.5)^(2000/500)
N/No = 0.0625
Thus the percent left = 0.0625 * 100 = 6.25%
Learn more about half life of a nucleus:https://brainly.com/question/23518766
#SPJ1
Which type of electromagnetic wave has less energy than a microwave?
OA. Ultraviolet wave
OB. Radio wave
O C. An X-ray
OD. Infrared wave
A 2. 75-l container filled with co2 gas at 25°c and 225 kpa pressure springs a leak. When the container is re-sealed, the pressure is 185 kpa and the temperature is 10°c. How many moles of gas were lost?.
Answer:
Moles Lost = 0.0335 moles
Explanation:
This type of question requires the Ideal Gas Law equation. The equation looks like this:
PV = nRT
In this formula,
-----> P = pressure (kPa)
-----> V = volume (L)
-----> n = number of moles
-----> R = constant (8.314 L*kPa/mol*K)
-----> T = temperature (K)
(Step 1)
To find how many moles were lost, you first need to find how many moles you had to begin with. This can be done by plugging the starting values into the equation and solving for "n". But first, you need to convert Celsius to Kelvin (by adding 273.15).
P = 225 kPa R = 8.314 L*kPa/mol*K
V = 2.75 L T = 25°C + 273.15 = 298.15 K
n = ?
PV = nRT
(225 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(298.15 K)
618.75 = n(2478.8191)
0.250 = n
(Step 2)
Next, you need to find the number of moles in the container after it has been re-sealed. The volume is the same because the container did not change. The process should be the same as above.
P = 185 kPa R = 8.314 L*kPa/mol*K
V = 2.75 L T = 10°C + 273.15 = 283.15 K
n = ?
PV = nRT
(185 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(283.15 K)
508.75 = n(2354.1091)
0.216 = n
(Step 3)
Finally, you can find the number of moles lost by subtracting the final amount of moles from the original amount. When doing this calculation, I used the value of the moles saved in my calculator (with more decimal places) to get a more accurate number.
Moles Lost = Initial Moles - Final Moles
Moles Lost = 0.250 moles - 0.216 moles
Moles Lost = 0.0335 moles
Which two protests evolved from symbolic relationships of organism which resulted in eukaryotic organisms chloroplast
Red algae and euglena evolved from a symbiotic relationship of organisms, which resulted in eukaryotic organisms containing chloroplasts
Theory of endosymbiosis:
Early eukaryotes developed by the symbiotic connection of prokaryotes, in accordance with the endosymbiosis idea. Which two protists underwent symbiotic evolution, leading to the development of eukaryotic creatures with chloroplasts.
-Symbiotic relationships between two or more prokaryotic cells led to the evolution of the first eukaryotic cells. Greater prokaryotic cells invaded or devoured smaller prokaryotic cells. The connection provided a secure home and nourishment for the tiny cells. By absorbing part of the organic molecules or energy generated by the endosymbionts, the bigger cells (now referred to as hosts) profited.
To learn more about endosymbiosis refer : https://brainly.com/question/1698852
#SPJ4
What is the mass in grams of 4.85 x 10^22 Al atoms? (Report your answer to two places past the decimal
Answer:
2.17 gm Al
Explanation:
First, find the number of moles . Then multiply by the mole weight of aluminum.
# moles = 4.85 x 10^22 / 6.022 x 10^23 = .08053 moles
.0805 moles * 26.981 gm/mole = 2.173 gm
what is the approximate distance from the far edge of one lobe to the far edge of the other?
The approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.
What is distance between far edge of two lobes in solar system?
This distance measures the outer space between the edges of the two lobes in a given time.
The approximate distance from the far edge of one lobe to the far edge of the other in a solar system is about 2,100,000 light-years.
Thus, the approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.
Learn more about distance here: https://brainly.com/question/2854969
#SPJ11
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please
Answer:
1-bromo-6-chloro-5-methylheptane
Explanation:
There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.
The longest carbon chain consists of 7 carbons.
There are no double bonds, based on the saturation and substituents.
So you have a 1-bromo-6-chloro-5-methylheptane.
Hope that was the brainliest answer!
An exergonic reaction __________ free energy, and an endergonic reaction __________ free energy.
Answer:
An exergonic reaction releases free energy, and an endergonic reaction absorbs free energy.
Explanation:
hope it helps
A 35. 0-l steel tank at 20. 0?c contains acetylene gas, c2h2, at a pressure of 1. 39 atm. Assuming ideal behavior, how many grams of acetylene are in the tank?.
52.66 grams of acetylene are in the tank.
PV=nRT is the formula for ideal gases, where P is the pressure and R is the constant and T is the temperature (P is 1.39 atm in this case)
Volume = 35.0 L
Gas constant = 0.08206 L.atm/K.mole
Temperature = 20.0 °C = 293 °C
We also know that we can apply the formula ;
Number of mole(n) = [tex]\frac{MmPV}{RT}[/tex]
m = ( 26.04 × 1.39 × 35 )/ (0.08206 × 293.15)
m = 52.66 g
Thus, the mass is 52.66 grams.
Learn more about ideal gases here:
https://brainly.com/question/12281987
#SPJ4
1s22s²2p63s23p64s²3d104p5
Which element is this?
Answer: bromine
Explanation:
There are a total of 2+2+6+2+6+2+10+5=35 electrons, meaning there are 35 protons. The element with atomic number 35 is bromine
An educated guess which explains observations is called:
a a law
b an experiment
c a hypothesis
d a variable
Answer:
c. a hypothesis is the correct answer
Explanation:
It is the year 2040, and you are a research scientist. The amount of sunlight that reaches the earth has been drastically reduced due to a major event like pollution, fires, or volcanoes. Farmers are asking you for help to save their failing crops.
The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab. How many moles of dextrose is this equivalent to?
The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab the moles of dextrose is this equivalent to is 3.6888 moles.
What are moles?A mole is described as 6.02214076 × 1023 of a few chemical unit, be it atoms, molecules, ions, or others. The mole is a handy unit to apply due to the tremendous variety of atoms, molecules, or others in any substance.
To calculate molar equivalents for every reagent, divide the moles of that reagent through the moles of the restricting reagent. The calculation is follows:
655/12 x 6 + 12+ 16 x 6 = 655/ 180 = 3.6888 moles.Read more about moles:
https://brainly.com/question/24322641
#SPJ1
Which phrase describes a homogeneous catalyst?
Answer:
It is in the same phase as the reactants.
Explanation:
i took the test
A 126.1-gram block of granite at 92.6°c is dropped into a tub of water at 24.7°c in an isolated system. the final temperature of both the granite and the water is 51.9°c. the specific heat capacity of granite is 0.795 joules/gram degree celsius, and the specific heat capacity of water is 4.186 joules/gram degree celsius. the granite block transferred of energy, and the mass of the water is .
The granite block transferred 4,080 joules of energy, and the mass of the water is 35.8 grams.
How we calculate heat transfer of any system ?Heat transfer in any system can be calculated as follow:
q = mCΔT
Given ;
m = mass of granite = 126.1 g C = specific heat of granite = 0.795 joules/gram degree CelsiusΔT = change in temperature of granite = 51.9 °C - 92.6 °C = -40.7 °CPutting all the values in folowing equation,
q = mCΔT
we get
q = 126.1 × 0.795 × -40.7 = -4080 J
Now by using same formula, we can also calculate the mass of water in the following way:
m = q / CΔT
where
C = specific heat of water = 4.186 joules/gram degree Celsius ΔT = change in temperature of water = 51.9 °C – 24.7 °C = 27.2 °CPutting all these values ;
m = -4080 / 4.186 × 27.2 = 35.8 g.
Hence, 4,080 joules of energy is transferred by granite block and 35.8 g is the mass of water.
To learn more about heat transfer here ;
brainly.com/question/18980657
#SPJ1
The molecular structure of water has an asymmetrical arrangement of hydrogen atoms causing.
Answer:
the asymmetrical arrangement of hydrogen atoms in a molecule of water causes the molecule to be polar, with the hydrogen atoms having a slightly positive charge, and the oxygen atom having a slightly negative charge.
In photosynthesis, plants use energy from the sun to produce glucose, c6h12o6 , and oxygen from the reaction of carbon dioxide and water.
6co2 + 6h2o --> c6h12o6 + 6o2
what mass, in grams, of glucose is produced when 3.00 mol of water react with carbon dioxide?
Answer: 324 g (to 3 sf)
Explanation:
Based on the coefficients of the equation, we know that when 3.00 mol of water is consumed, 3.00 mol of carbon dioxide is also consumed.
The atomic mass of carbon is 12.011 g/mol.The atomic mass of oxygen is 15.9994 g/mol.Thus, the formula mass of carbon dioxide is:
[tex]6(15.9994)+12.011=108.0074[/tex] g/mol.
Thus, 3.00 mol has a mass of (108.0074)(3.00)=324 g (to 3 sf)
Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermic
reaction ?
O The fireworks produce colors.
O The fireworks give off heat.
O Igniting the fireworks requires energy.
O Igniting the fireworks makes an odor.
The best explanation for why a firework being ignited is an example of an exothermic reaction and not an endothermic reaction is:
The fireworks give off heat.
Heat is emitted into the environment in an exothermic reaction. When a firework is lit, it undergoes a number of chemical processes inside the firework combination, which produces gases and produces a great deal of heat. Fireworks' distinctive visual display and audible effects are produced when heat is released as light and sound.
In contrast, heat is taken from the environment during an endothermic reaction. If a reaction were endothermic, it would need an outside energy source to continue, and because it would be absorbing heat from its environment, it would feel chilly to the touch.
However, because they release heat and energy and brighten the night sky, fireworks are instances of exothermic reactions.
To know more about heat:
https://brainly.com/question/32136211
#SPJ2
Which of the following species of fish have cartilaginous skeletons?
Answer:
sharks have cartilaginous skeletons
Explanation:
Sharks are an example
What conditions make AG always positive?
Answer: when a reaction absorbs heat or decreases the entropy of the system,
Explanation: :)
What kind of air mass will bring cold, dry weather as it moves toward an area
Answer:
i think the answer is Continental polar air masses
Explanation:
Compare
Ion and Radical
Atom and molecule
Organic and inorganic compounds
Answer:
'An ion has a non-zero electric charge. A radical has an atom with unfilled electron shells and so is very reactive, but is electrically neutral.'
'Atoms are single neutral particles. Molecules are neutral particles made of two or more atoms bonded together.'
'The primary difference that lies between these organic compounds and inorganic compounds is that organic compounds always have a carbon atom while most of the inorganic compounds do not contain the carbon atom in them.'
Organic and inorganic compounds:
Similarities:::---
1) In both organic and inorganic compound, the elements joining in making compound complete their octet.
2) Organic compound shows isomerism (R/S , E/Z , cis/trans, enantiomers, diastereomers, etc), just as inorganic compound do (Δ/Λ, enantiomers, R/S enantiomers, cis/trans, fac/mer isomers, etc).
3) Organic compound and inorganic compounds can be very active in chemical reactions, e.g. organolithium reagents could be flammable or even pyrophoric (generally stored under 10°C), while inorganic reagents like in this paper are quite rapid...
Differences:::---
1) Organic compound are very long in size so they can make polymer but inorganic compound are not very long but its structure might me complex.
2) The boiling,melting point of organic compound is lass than inorganic compound.
3) Organic compound always contains carbon but inorganic compounds might not.
4) Organic compound
_____________________________
Ion and Radical Atoms:
In some sense they are a bit similar. The main difference is that a neutral radical has no charge imbalance between the protons and electrons, but the cation or anion does.
Ions are written with an explicit charge because of that charge imbalance, but radicals may or may not have an imbalance of charge. Just because a molecule is a radical doesn't mean it's neutral.
For example, if you shoot 2-pentanone with an electron beam for Electron "Impact" Mass Spectroscopy, where you essentially study molecules whose structures break into smaller pieces as a result of interacting with stray electrons to identify the molecules, you get a cationic radical (middle, or far right of the following diagram).
There are 8.421 g of dry ZnSO4 and
6.579 g H₂O in the sample.
Step 2: Determine the moles of water and anhydrous compound.
Zn = 65.38 g/mol, S = 32.07 g/mol,
H = 1.01 g/mol, O = 16.00 g/mol
How many moles of ZnSO4 are present?
[?] mol ZnSO4
The number of moles of H₂O is 0.36 mol.
The number of moles of LiClO₄ is 0.0521 mol.
What are moles?Mole is an important standard unit used for the measurement of large quantities of atoms, molecules, or other particles. One mole is equal to 6.022×10²³ units.
The number of moles of a substance is calculated by:
Moles =[tex]\frac{mass}{molar \;mass}[/tex]
To find the number of moles of H₂O:
Mass of H₂O in the sample = 6.579 g
The molecular weight of H₂O = 18.02g
Moles = [tex]\frac{mass}{molar \;mass}[/tex]
Moles = [tex]\frac{6.579 g}{18.02g}[/tex]
Moles = 0.36
To find the number of moles of [tex]ZnSO_4[/tex]:
Mass of [tex]ZnSO_4[/tex] in the sample = 8.421 g
The molecular weight of [tex]ZnSO_4[/tex]= 161.47 g/mol
Moles =[tex]\frac{mass}{molar \;mass}[/tex]
Moles = [tex]\frac{8.421 g}{161.47 g/mol}[/tex]
Moles = 0.0521 moles
Learn more about moles here:
https://brainly.com/question/8455949
#SPJ1