Packs of stickers
Buy for €1.50a pack
Sell For £2.25 a pack
Media buys 5 pack's and sells them all
How Much profit does she
Make ?

Answers

Answer 1

Answer:

€3.75

Step-by-step explanation:

1. Formulate:

5×(2.25 - 1.5)

2. Calculate:

5×(2.25-1.5)

5× 0.75

=3.75

Answer

3.7/ €3.7


Related Questions

Help please I need as quick as possible!

Answers

Answer: [tex]\sum^{24}_{n=1} (4n+5)[/tex]

Step-by-step explanation:

This is an arithmetic series with a common difference of 4, so we can immediately eliminate the two left-hand options.

To determine which of the two options on the right is correct, we can determine the first term of each sum expanded out.

For the top right, the first term is 4(0)+5=5, which does not match the first term of the given sequence.For the bottom right, the first term is 4(1)+5=9, which does match the first term of the given sequence.

please help

0.06/1.71

Answers

Answer:

0.04

Step-by-step explanation:

0.03508772

If x = 3, then 3x – 4 = 5. x = 3 law of detatchment

Answers

Answer:

3x-4=5

Step-by-step explanation:

it is correct

What is the answer to this question?
Y=x^2-1 with the input as 5

Answers

We can see that, when the input is 5, the output is 24.

How to evaluate an equation?

Here we have the equation:

[tex]y = x^2 - 1[/tex]

Where y is the output and x is the input.

We want to evaluate it with the input as 5, so we need to replace the variable x by the number 5, we will get:

[tex]y = 5^2 - 1 = 24[/tex]

Then we can see that, when the input is 5, the output is 24.

If you want to learn more about evaluating functions:

https://brainly.com/question/1719822

#SPJ1

Rewrite the expression as a fraction.

Answers

8/17 put the 8 over the 17 because it’s being divided by the number 17

I don't even know Brian tanks

The volume of a can of Pepsi is 0.33liter. There are 12 cans in 1 carton
What is the volume of 5 cartons of Pepsi?

Answers

Answer:

19 liters 800 milliliters

Step-by-step explanation:

0.33 * 12 * 5 = 19.8 liters

what is the slope of the line through the points (-2,-1) and (8,-3)

Answers

Answer:

Step-by-step explanation:

Using slope m = y_2-y_1/x_2-x_1 to find the solution slope that passes through those two-point.

Point-slope form into y-intercept form.

Answer:

For finding slope

we have the formula

m = y2 - y1/ x2 - x1

x1 = (-2)

x2. = ( 8)

y1. = (-1)

y2 =(-3)

putting the value of this in the formula we get,

m = (-3)-(-1)/8-(-2)

m = (-3+1)/8 + 2.

m = (-2)/10

m = (-1)/5.

m = (-1)/5

Explain the steps you would take to find the quotient of

1
3
÷ 4
3

Answers

1/3 divided by 4/3

Or

13 divided by 43
Which is the question??

If the price charged for a candy bar is p(x) cents, then x thousand candy bars will be sold in a certain city, where p(x)= 155-(x/10):
a. find an expression for the total revenue from the sale of x thousand candy bars.
b. find the value of x that leads to maximum revenue
c. find the maximum revenue

Answers

The expression for the total revenue from x thousand sales is 155,000x - 100x².

The value of x is 775 cents and the maximum revenue is $60,062,500.

What is the maximum revenue?

First, come up with an expression for total revenue from x thousand sales:

= (155  - x /10 ) × x × 1,000 units

= 155,000x - 100x²

The value of x would then be:

Derive the function from the total revenue function to give:

0 = 155,000 - 200x

x = 775 cents

The maximum revenue is therefore:

= 155,000(775) - 100(775)²

= $60,062,500

Find out more on finding the maximum revenue at https://brainly.com/question/11829776.

#SPJ1


An electrical resistor is rated at 4500 ohms ± 3%. Express this tolerance in ohms and state the
actual range of resistance.

Answers

Answer:

Range =  4365-4635

Step-by-step explanation:

4500 * 3/100 = 135

4500 + 135  = 4635

4500 - 135  = 4365

Range =  4365-4635

The actual range of resistance is from 4365 ohms to 4635 ohms.

How to determine the tolerance in ohms and state the actual range of resistance.

To express the tolerance in ohms, we need to calculate 3% of the rated resistance, which is 4500 ohms.

Tolerance in ohms = 3% of 4500 ohms

Tolerance in ohms = 0.03 * 4500

Tolerance in ohms = 135 ohms

The actual range of resistance can be found by adding and subtracting the tolerance from the rated resistance:

Lower limit = Rated resistance - Tolerance

Lower limit = 4500 ohms - 135 ohms

Lower limit = 4365 ohms

Upper limit = Rated resistance + Tolerance

Upper limit = 4500 ohms + 135 ohms

Upper limit = 4635 ohms

So, the actual range of resistance is from 4365 ohms to 4635 ohms.

Learn more about resistance at https://brainly.com/question/28135236

#SPJ3

The perimeter of a​ standard-sized rectangular rug is 24 ft. The length is 2ft longer than the width. Find the dimensions.

Answers

The length and width of the rectangle are equal to: 7 ft and 5 ft, respectively

Quadrilaterals

There are different types of quadrilaterals, for example, square, rectangle, rhombus, trapezoid, and parallelogram.  Each type is defined accordingly to its length of sides and angles. For example, in a rectangle,  the opposite sides are equal and parallel and their interior angles are equal to 90°.

The perimeter of a geometric figure is the sum of its sides. Thus, for a rectangle, the perimeter is 2L+2W.

For this question, the length is 2ft longer than the width - L=2+W. Thus,

24=2*(2+W)+2W

24=4+2W+2W

24-4=4W

20=4W

W=5 ft

If W=5, L will be 2+5=7 ft.

Read more about the perimeter here:

https://brainly.com/question/24571594

$SPJ1

Which expression is equivalent to...

Answers

Answer:

A is correct yes

Step-by-step explanation:

ndnanndnqnjed

Find the sum of the first six terms in the sequence {1, 5, 9, 13, …}

Answers

Answer:

66

Step-by-step explanation:

The sequence you provided seems to be arithmetic as it increases as 4 each term. Assuming 1 is the first term the equation would be [tex]a_{n}=1 + 4(n-1)[/tex]. You could just take the first 6 terms and add them together since you already have 4 values calculated and you could calculate the other 2 by adding 4. This would give you

(1 + 5 + 9 + 13 + 17 + 21) = 66

But there's an easier way to do it. You could use the formula [tex]S_n = \frac{n(a_1 + a_n)}{2}[/tex]. You can calculate [tex]S_6[/tex] by plugging in those values. You would need to calculate [tex]a_6[/tex] before hand, but you can calculate that using the formula I defined above. Which in general is [tex]a_n = a_1 + d(n-1)[/tex] where d is like the slope, or how much it changes each term. So if you calculate [tex]a_6[/tex] you'll get [tex]1+4(6-1) = 1+4(5) = 21[/tex]. Now plug this into the series formula above and you get [tex]S_6 = \frac{6(1+21)}{2}=\frac{6(22)}{2}=\frac{132}{2}=66[/tex] which is exactly what you get if you add the first 6 terms as shown above when you do it manually.

[tex]\text{First let's find two more terms, because we have only six. We can do that by}\\\text{adding 4:: 13+4=17; 17+4=21}[/tex]

[tex]\rule{300}{1.7}[/tex]

[tex]\text{Now we just add the terms: 1+5+9+13+17+21}[/tex]

[tex]\rule{300}{1.7}\\\text{66}[/tex]

On the average, five smokers pass acertain street corners every ten minutes, what is the probability that during a given 10 minutes the number of smokers passing will be A. 6 or fewer B. 7 or more C. Exactly 8​

Answers

Answer:

The answer will be A. 6 or fewer.

The probability that during a given 10 minutes the number of smokers passing will be 6 or fewer.

What is probability?

Probability can be defined as the ratio of the number of favorable outcomes to the total number of outcomes of an event. For an experiment having 'n' number of outcomes, the number of favorable outcomes can be denoted by x. The formula to calculate the probability of an event is as follows.

Probability(Event) = Favorable Outcomes/Total Outcomes = x/n

Example

Suppose we have to predict about the happening of rain or not. The answer to this question is either "Yes" or "No". There is a likelihood to rain or not rain. Here we can apply probability. Probability is used to predict the outcomes for the tossing of coins, rolling of dice, or drawing a card from a pack of playing cards.

Terminology of Probability Theory

The following terms in probability help in a better understanding of the concepts of probability.

Experiment: A trial or an operation conducted to produce an outcome is called an experiment.

Sample Space: All the possible outcomes of an experiment together constitute a sample space. For example, the sample space of tossing a coin is head and tail.

Favorable Outcome: An event that has produced the desired result or expected event is called a favorable outcome. For example, when we roll two dice, the possible/favorable outcomes of getting the sum of numbers on the two dice as 4 are (1,3), (2,2), and (3,1).

Trial: A trial denotes doing a random experiment.

Given:

There are 5 smokers who passes by in every 10 minutes.

So, the probability that during a given 10 minutes the number of smokers passing will be approx 5 or less.

i.e., 6 or fewer.

Learn more about probability here:

https://brainly.com/question/11234923

#SPJ2

can someone please help me

Answers

Part 1

f(2) represents the value of y when x=2, which is 3

Part 2

We need to find the value of x that makes y=2, which is -1

One number is 6 more than twice another. If their sum is 51, find the numbers.
Which of the following systems of equations represents the word problem?
y = 2x + 6 and y = x + 51
y = 2x + 6 and x + y = 51
y = 2(x + 6) and x + y = 51

Answers

Answer:

y = 2x + 6 and y + x = 51

Step-by-step explanation:

the first number is y

the second number is X

" 6 is more than" implying +

"6 is more than twice another" implying y = 6 + 2 multiples by the second number "X"

their sum is equal to 51

add first and the second number

that is

y+x = 51

so we have

y = 6+2x and y +x = 51

A person draws a card from a hat. Each card is one color, with the following probabilities of being drawn: 1/25 for red, 1/20 for green, 1/15 for purple, and 1/10 for black. What is the probability of pulling a green or red card, written as a reduced fraction?

Answers

Probability helps us to know the chances of an event occurring. The probability of pulling a green or red card is 9 / 100.

What is Probability?

Probability helps us to know the chances of an event occurring.

P =  [tex]\dfrac{Desired \ outcomes}{Posiible \ outcomes}[/tex]

The probabilities of different color cards being pulled are 1/25 for red, 1/20 for green, 1/15 for purple, and 1/10 for black Therefore, the probability of pulling  a green or red card is,

Probability = 1/20 + 1/25

                 = (5 + 4) /100

                 = 9 / 100

Hence, the probability of pulling a green or red card is  9 / 100.

Learn more about Probability:

brainly.com/question/795909

#SPJ1

Please answer all 3 questions I will give brainliest if I can if ur right!

Answers

Answer:

1. 30 ft

2. sqrt(2164) yd

3: 12 cm

Step-by-step explanation:

For all three questions I'll be using the Pythagorean Theorem which states that a^2 + b^2 = c^2 where c is the hypotenuse and a and b are the base and height

Question 1:

40^2 + d^2 = 50^2

1600 + d^2 = 2500

d^2 = 900

d = 30

Question 2:

42^2 + 20^2 = c^2

2,164 = c^2

c = sqrt(2164)

Question 3:

5^2 + a^2 = 13^2

25 + a^2 = 169

a^2 = 144

a = 12

A fire fighter sees a woman trapped in the building 81 feet up from the bottom floor. If the firetruck is parked 41 feet away from the bottom of the building, at what angle of elevation, to the nearest degree, shut the fire fighter extend the ladder to reach the woman?

Answers

Answer:
63 Degrees

Steps:
Use the Pythagorean Theorem to find the missing side.

a^2 + b^2 = c^2
c = SQRT(a^2 + b^2)

c = SQRT(81^2 + 41^2)
c = SQRT(8242)
c = 90.785

ASIN is the inverse of sine.

1
..S
4 in.
Find h.
10 in.
h = √[?] in.

Answers

Answer:

√96

Step-by-step explanation:

halve the diameter to set up the pythagorean theorem

2²+b²=10²

4+b²=100

-4 on each side

b²=96

square root each side

b=√96

it could the be further simplified to 4√6

Which expressions are equivalent to the given equation. Logarithmic form

Answers

The expression that is equivalent to the given logarithm equation is log₄ 1 / 4  + log₄ x²

How to solve logarithm?

log₄ (1 / 4 x²)

Using logarithm law, the logarithm can be express as follows;

using logarithm law,

Therefore, the expression that is equivalent to the given logarithm equation is as follows:

using addition law for logarithm,

log₄ (1 / 4 x²) = log₄ 1 / 4  + log₄ x²

learn more on logarithm here: https://brainly.com/question/2428816

#SPJ1

A manpaid rs 510 as income tax when it was 5 paisa per rupee what was his income?

Answers

The income of the man in discuss as in the task content is; rs 10,200.

What is the income of the man?

Since, it follows that 100 paisas make one rupee. This insinuates that the income tax rate which corresponds to 5 paisa per rupee is; 5%.

Hence, the amount earned by the man in discuss can be evaluated as follows;

(5/100) × Income = 510

Hence, Income = 510/0.05 = rs 10,200.

Read more on percentages;

https://brainly.com/question/843074

#SPJ1

Determine whether each set of data can be modeled by an exponential function. If so, find the exponential
function that fits the data.

Answers

It can be modeled by an exponential function, f(x) is divided by 3 each time x increases by 1.

This means that the base of the exponential function is 1/3, and since the value of f(x) when x=0 is 81, [tex]f(x)=81\left(\frac{1}{3} \right)^{x}[/tex]

Greg has a piece of string that is 3 1/3 yards long. If he cuts off 3/4 yard, how many yards of the string
will be left?

Answers

2(7/12) yards will be left

3(1/3) =10/3
10/3 - 3/4. = 40/12- 9/12
= 31/12
=. 2(7/12)

A line passes through (-9,-6) and has an undefined slope. Write an equation of the line satisfying the given conditions.
A. x= -9
B. y= -9
C. y= -6
D. x= -6

Answers

The equation of the line is x = -9 , Option  is the correct answer

What is the equation of a line ?

The equation of a line is given by y = mx+c

where m is the slope and c is the intercept

It is given that

A line passes through (-9,-6) and has an undefined slope.

undefined slope means it is a vertical line at -9

Therefore the equation of the line is x = -9 , Option  is the correct answer

To know more about Equation of Line

https://brainly.com/question/959487

#SPJ1


What single transformation was applied to triangle A to get triangle B?

Choose 1 answer:
Translation
Rotation
Reflection
Dilation

Answers

The answer is Reflection

1

x

If
y
=
3
when
x
=
36
find,
y
when
x
=
9

Answers

Answer:

3y= 36×9x

3y=324x

y=324÷3

y=108 ans

Find the number of distinguishable ways the letters of the following word can be arranged. KNICKKNACK

Answers

The number of distinguishable ways the letters of the following word can be arranged 'KNICKKNACK' is 37800.

When the order of the arrangements counts, a permutation is a mathematical technique that establishes the total number of alternative arrangements in a collection. Choosing only a few items from a collection of options in a specific sequence is a common task in arithmetic problems.

The number of different permutations of n objects with m₁ repeated items, m₂ repeated items,...,mₙ repeated items can be computed as

m!/(m₁!)(m₂!)...(mₙ!)

Here, the letter 'KNICKKNACK' is a total of 10 letters with 4 K's, 2 N's, 1 I, 2 C's, and 1 A.

So, the number of possible arrangements is

(10!)/(4!*2!*1!*2!*1!) = (10*9*8*7*6*5*4!)/(4!*2*2) = 10*9*7*6*5*2 = 37800

Therefore the number of distinguishable ways the letters of the following word can be arranged 'KNICKKNACK' is 37800.

Learn more about permutations here -

https://brainly.com/question/4301655

#SPJ10

express 2.603603603 . . . as a rational number

Answers

Answer:

[tex] \frac{289}{111} [/tex]

Step-by-step explanation:

[tex]2 + \frac{603}{1000 - 1} = 2 \frac{603}{999} = 2 \frac{67}{111} = \frac{289}{111} [/tex]

A group of 9 people is going to be formed into committees of 4, 3, and 2 people. How many committees can be formed if no person can serve on more than one committee?

Answers

Answer:

1,260

Step-by-step explanation:

[tex]\implies C(9,4)*C(5,3)*C(2,2)[/tex]

[tex]\implies 9!/4!(9-4)!*5!/3!(5-3)!*2!/2!(2-2)![/tex]

[tex]\implies 9!/4!5!*5/3!2! *2!0![/tex]

[tex]\implies (9 * 8 * 7 * 6 / 4 * 3 * 2 * 1) * (5 * 4 / 2 * 1) * 1[/tex]

[tex]\implies 1260[/tex]

Therefore, 1,260 committees can be formed.

Other Questions
The nurse is reviewing lifestyle changes with a client who is attempting to reduce the risk for colon and prostate cancer. Which statement by the client requires further follow-up by the nurse Two students are planning an experiment that will test how planaria (aquatic flatworms) respond to different environments. They will conduct two investigationsone that tests the worms responses to different water temperatures and one that tests the worms responses to different levels of acidity. Student 1 wants to buy two groups of flatworms and use a different group for each investigation. Student 2 thinks the same group of worms should be used for both investigations.Do you think either students method would give more accurate results? Why or why not? Explain your response. 18.He.( not/marry) her because she (break) up with him last year. Elizabeths first research question is How did Theseus overcome the Minotaur? What should her second research question be, and what would be the most credible source for research? What is the coefficient of the third term in the binomial expansion of (a b)6? 1 15 20 90 Read the scenario.A biologist is studying golden frogs that live in cool streams running through the rain forests of Central America. The biologist conducts a survey of the population and counts over 100 frogs in one mile of stream. The biologist returns to the same location one year later and counts only 20 frogs in that same stretch of stream. The biologist wonders why there are suddenly so few golden frogs.The biologist also observes that a mining company has set up a copper mine only a few miles from the stream. By reading studies on copper mining operations in other parts of the world, the biologist learns that the wastewater runoff from the mines is highly acidic and contains potentially toxic compounds.Which part of the scientific method is best illustrated by the biologist wondering why there were so few frogs in the second year compared to the first?a making an observation and asking a questionb collecting datac setting up an experimentd forming a hypothesis are sunglasses allowed at school on really hot UV rays and days What is the volume of a cone with a height of 22 and a radius of 6 what is the decimal value that representsthe total percent markdown for the following scenario, after being rounded to the nearest percent:50%, 31%,and 9% ind two negative and three positive angles, expressed in radians, for which the point on the unit circle that corresponds to each angle is (2/2,2/2). Demonstratives exercise_______ two jumpers are nice but ______ is better than ________.These / those / thisThese / this / thatThat / this / theseThis / these / thatWhy did you choose _____ jeans? Do you see the jeans on the shelf over there? I think _________ jeans are prettier.this / thatthose / thisthese / thosethese / thisWhen I look at ______ photos, I really miss my old days. ______ were the happiest days of my life.those / thatthis / thosethese / thosethat / thisThanks for showing me round your neighborhood. ____________ really lovely.This place isThose place areThese place isThis place areSee _________ gorgeous man over there? ________ is my cousin, Brian.that / thosethis / thatthat / thatthis / this What is the mass in grams of 4.85 x 10^22 Al atoms? (Report your answer to two places past the decimal Read the passage from "What It Takes to Prepare for the Iditarod."In earty winter, mushers begin accumulating the food and equipment that will be shipped ahead to each checkpoint of the race. Each musher ships a total about 3,000 pounds of food and supples. All of this comes at a price. Estimates of the cost for a musher to enter a team in the Iditarod range upwards of $50,000 for a winning team. In order to pay for this, most mushers solicit sponsors. It is probably the musher's least favorite job. "You can end up feeling like you're seling your soul for money," cited one competitor.First question: Which best describes the tone of this passage?- The tone is frustrated, because It is very expensive to race in the Iditarod.- The tone is disappointed, because the mushers do not always get the money they need to race in the Iditarod.- The tone is boring, because the information is not important for racing in the Iditarod.- The tone is encouraging, because the mushers can rely on others to pay the costs of the Iditarod.Second question: How does the idiom selling your soul contribute to the meaning of this passage?-It shows that the mushers don't like having to rely on sponsors so they can race in the Iditarod-It shows how time-consuming it is for the mushers to work with sponsors when they race in the Iditarod.-It shows that the mushers work harder on finding sponsors, than on training to race in the Iditarod.-it shows how difficult it is for the mushers to find sponsors to cover the costs of the racing in the Iditarod Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please what are the main functions of drinking water and sanitation project in Western Nepal Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermicreaction ?O The fireworks produce colors.O The fireworks give off heat.O Igniting the fireworks requires energy.O Igniting the fireworks makes an odor. What countries in Europe have the highest population densities? Jeremy is reading a 60-page book. He read the first 20 pages in 30 minutes. If Jeremy continues to read a the same rate, how long will it take him to finish the book? Predict the shape of the molecule. write 9 430 049 in international number system