Answer:
The standard form of the equation of a circle is
(
x
−
a
)
2
+
(
y
−
b
)
2
=
r
2
where (a,b) are the coords of the centre and r , the radius.
x
2
+
y
2
=
16
is in this form
with a = b = 0 and r = 4
hence this circle has centre at the origin (0,0) and radius 4
The intercepts will therefore be (± 4,0) and (0, ± 4 )
Consider the following equation. f(x, y) = sin(4x + 3y), P(−6, 8), u = 1 2 3 i − j (a) Find the gradient of f. ∇f(x, y) = (b) Evaluate the gradient at the point P. ∇f(−6, 8) = (c) Find the rate of change of f at P in the direction of the vector u. Duf(−6, 8) =
Answer:
Step-by-step explanation:
a) Find the gradient
[tex]\nabla f(x,y) =f_x(x,y)\bold{i} +f_y (x,y)\bold{j}[/tex]
[tex]Also, sin(4x+3y)= sin(4x)cos(3y)+sin(3y)cos (4x)[/tex]
[tex]f_x(x,y) = 4cos(4x)cos(3y)-4sin(3y)sin(4x) = 4 cos(4x-3y)[/tex]
[tex]f_y(x,y) = -3sin(4x)sin(3y)+3cos(3y)cos(4x)=3cos(4x-3y)[/tex]
Hence
[tex]\nabla f(x,y) = 4cos(4x-3y)\bold{i}+3cos(4x-3y)\bold{j}[/tex]
b) At point (-6, 8) just replace the values in gradient to find it out. You can do it.
c) directional derivative in the direction u.
[tex]D_uf(x,y)=\nabla f(x,y). u[/tex]
I stuck with your 1 2 3 i -j . What does 1 2 3 mean? is it not 123 or 1 2/3 or else?
In one lottery, a player wins the jackpot by matching all five numbers drawn from white balls (1 through 41) and matching the number on the gold ball (1 through 31). If one ticket is purchased what is the probability of winning the jackpot?
(Type answer as an integer or a simplified fraction)
Answer:
1 / 2,787,760,560
Step-by-step explanation:
The number of permutations is:
41 × 40 × 39 × 38 × 37 × 31 = 2,787,760,560
So the probability of winning the jackpot is 1 / 2,787,760,560.
-3× + 1 + 10x = x + 4
Answer:
I WANT BRAINLIESTStep-by-step explanation:
your question is
[tex]-3*1 + 10x = x+4[/tex]
-3+10x=x+4
9x=7
x = 7/9
Answer:
x=7/9
Step-by-step explanation:
Step 1: Simplify both sides of the equation.
(−3)(1)+10x=x+4
−3+10x=x+4
10x−3=x+4
Step 2: Subtract x from both sides.
10x−3−x=x+4−x
9x−3=4
Step 3: Add 3 to both sides.
9x−3+3=4+3
9x=7
Step 4: Divide both sides by 9.
9x
9
= 7 /9
x= 7 /9
What’s the correct answer for this question?
Answer:
The answer is drawing the 6 of clubs or the 6 of spades because those are the only black 6's.
What is the simplified value of the exponential expression 16^1/4
1/2
1/4
2
4
Answer:
2
Step-by-step explanation:
16 ^ (1/4)
Rewriting 16 as 2^4
2^4 ^ 1/4
We know that a^b^c = a^(b*c)
2 ^ (4*1/4)
2 ^1
2
The right answer is 2.
please see the attached picture for full solution
Hope it helps
Good luck on your assignment
Find both the vector equation and the parametric equations of the line through (0 comma 0 comma negative 2 )(0,0,−2) in the direction of the vector Bold vvequals=left angle negative 2 comma negative 4 comma 0 right angle−2,−4,0, where tequals=0 corresponds to the given point.
The line (-2, -4, 0)t points in the same direction as the given vector (-2, -4, 0) and passes through the origin. To make this line pass through the point (0, 0, -2), all we need to do is translate the line by the vector (0, 0, -2). So the line has vector equation
u(t) = (-2, -4, 0)t + (0, 0, -2) = (-2t, -4t, -2)
and we see that t = 0 indeed corresponds to the given point.
In parametric form, the line is given by
x(t) = -2t
y(t) = -4t
z(t) = -2
for any real number t.
When Easton goes bowling, his scores are normally distributed with a mean of 130
and a standard deviation of 11. What percentage of the games that Easton bowls does
he score higher than 112, to the nearest tenth?
Answer:
P(X≥112) = 0.9495
The percentage of the games that Easton bowls does he score higher than 112 = 94.95%
Step-by-step explanation:
Given mean of the Population = 130
Given standard deviation of the Population = 11
Let X= 112
[tex]Z =\frac{x-mean}{S.D} =\frac{112-130}{11}=-1.636[/tex]
P(X≥112) = P(Z≥ z)
= 1-P(Z≤z)
= 1- ( P(Z≤-1.636)
= 1- (0.5-A(-1.636)
= 0.5 +A(1.636)
= 0.5 + 0.4495
P(X≥112) = 0.9495
The percentage of the games that Easton bowls does
he score higher than 112 = 94.95%
What is the equation of the horizontal line through (-5,-2)
Answer:
y = -2
Step-by-step explanation:
A horizontal line has an equation of the form ...
y = constant
In order for the line to go through a point with a y-coordinate of -2, the constant must be -2.
y = -2 . . . . horizontal line through (-5, -2)
cones and pyramids both have only one base ?
Answer:
Yes
Step-by-step explanation:
They both have only one base. They are different from prisms and cylinders.
What is the quotient of 3/4 divided by 1/5
Answer:
15/4
Step-by-step explanation:
3/4:1/5= 3/4*5= 15/4
Please answer this correctly without making mistakes
Answer:
56.52 mm²
Step-by-step explanation:
V= πr²h
V= 3.14*(6/2)²*2= 56.52 mm²
Educators are testing a new program designed to help children improve their reading skills. The null hypothesis of the test is that the program does not help children improve their reading skills. For the educators, the more consequential error would be that the program does not help children improve their reading skills but the test indicated that it does help.
Which of the following should the researchers do to avoid the more consequential error?
a. Increase the significance level to increase the probability of Type I error.
b. Increase the significance level to decrease the probability of Type I error.
c. Decrease the significance level to increase the probability of Type I error.
d. Decrease the significance level to decrease the probability of Type I error.
e. Decrease the significance level to decrease the standard error.
Answer:
a
Step-by-step explanation:
increase the significance level to increase the probability of type 1 error
You can use the definition of type I and type II error to find the correct option.
To avoid the more consequential error, the researchers should do:
Option D: Decrease the significance level to decrease the probability of Type I error.
Firstly the whole story starts from hypotheses. The null hypothesis is tried to reject and we try to accept the alternate hypothesis.
The type 1 error occurs if we get false positive conclusion (false positive means we accuse null hypothesis being wrong when it was actually correct).The type 2 error occurs if we get false negative conclusion (false negative means we accept null hypothesis when it was actually false).The negative is just like the doctor's test getting negative means no disease. Similarly, if we conclude null hypothesis negative means it is accepted. If it is accepted wrongly means the negative test result was false, thus called false negative. This error is called type II error.
How are the type I error and the level of significance of the hypothesis test related?The probability of committing the type I error is called the significance level of the hypothesis test.
How to find what does researchers should do to avoid more consequential error?Since in the given context, by using the definitions of the type I error and the type II error, we have
Type I error : False positive : Accepting that the new program does help the children in improving the reading skills when it actually don't.Type II error: False negative: Failing to reject that the program doesn't help the children in improving the reading skills when it actually improves the skill.More consequential error for educators : For the educators, the more consequential error would be that the program does not help children improve their reading skills but the test indicated that it does help.
Thus, the more consequential error for the educators is committing the type I error.
To prevent committing this error, they need to decrease type I error's probability which is denoted by level of significance, need to decrease the level of significance of the hypothesis test.
Thus,
Option D: Decrease the significance level to decrease the probability of Type I error.
Lear more about type I and type II error here:
https://brainly.com/question/26067196
Given P space equals space P subscript 0 space plus space rho g h, your objective is to determine the uncertainty of P by measuring P subscript 0 comma space rho comma space g space and space h , What is the expression for capital delta P subscript g , that is, the g's contributing term for the overall uncertainty of P
Answer:
the g's contributing term for the overall uncertainty of P is [tex]dP_g = [\frac{dg}{g}][/tex]
Step-by-step explanation:
From the question we are told that
The pressure is [tex]P = P_o + \rho gh[/tex]
The first step in determining the uncertainty of P in by obtaining the terms in the equation contributing to it uncertainty and to do that we take the Ln of both sides of the equation
[tex]ln P = lnP_o + ln(\rho gh )[/tex]
=> [tex]ln P = lnP_o + ln \rho + ln g + ln h[/tex]
Then the next step is to differentiate both sides of the equation
[tex]\frac{d(ln P)}{dP} = \frac{d(ln P_o)}{dP_o} + \frac{d(ln \rho)}{d\rho} +\frac{d(ln g)}{dg} + \frac{d(ln h)}{dh}[/tex]
=> [tex]\frac{dP}{P} = \frac{dP_o}{P_o} + \frac{d \rho}{\rho} +\frac{d g}{g} + \frac{d h}{h}[/tex]
We asked to obtain the contribution of the term g to the uncertainty of P
This can deduced from the above equation as
[tex]dP_g = [\frac{dg}{g}] P[/tex]
he mayor of a town has proposed a plan for the construction of a new community. A political study took a sample of 900 voters in the town and found that 81% of the residents favored construction. Using the data, a political strategist wants to test the claim that the percentage of residents who favor construction is more than 78%. Testing at the 0.02 level, is there enough evidence to support the strategist's claim?
Answer:
[tex]z=\frac{0.81 -0.78}{\sqrt{\frac{0.78(1-0.78)}{900}}}=2.173[/tex]
The p value for this case is given by this probability:
[tex]p_v =P(z>2.173)=0.0149[/tex]
Since the p value is lower than the significance level we have enough evidence to reject the null hypothesis and we can conclude that the true proportion of people who favored te construction is significantly higher than 0.78 or 78%
Step-by-step explanation:
Information given
n=900 represent the random sample taken
[tex]\hat p=0.81[/tex] estimated proportion of residents who favored the construction
[tex]p_o=0.78[/tex] is the value to test
[tex]\alpha=0.02[/tex] represent the significance level
z would represent the statistic
[tex]p_v[/tex] represent the p value
Hypothesis to test
We want to test if the true proportion is more than 0.78 or not.:
Null hypothesis:[tex]p\leq 0.78[/tex]
Alternative hypothesis:[tex]p > 0.78[/tex]
The statistic is given by:
[tex]z=\frac{\hat p -p_o}{\sqrt{\frac{p_o (1-p_o)}{n}}}[/tex] (1)
Replacing the info we got:
[tex]z=\frac{0.81 -0.78}{\sqrt{\frac{0.78(1-0.78)}{900}}}=2.173[/tex]
The p value for this case is given by this probability:
[tex]p_v =P(z>2.173)=0.0149[/tex]
Since the p value is lower than the significance level we have enough evidence to reject the null hypothesis and we can conclude that the true proportion of people who favored te construction is significantly higher than 0.78 or 78%
The sugar company will choose from two companies to transport its sugar to market. the first company charges $6500 to rent trucks plus an additional fee of $150.50 for each Ton of sugar. The second company charges $4995 to Trang trucks plus an additional fee of $225.75 for each Ton of sugar. For what amount of sugar do the two companies charge the same?
Answer:
20 ton
Step-by-step explanation:
We created a system of two separate equations to answer these questions.
"y" will be the total cost to transport the sugar
"x" will be the amount of sugar transported
Therefore, we have to:
y = 3995 + 225.50 * x
y = 6500 + 100.25 * x
We must establish these equations equal to each other because it asks how much of x is necessary to make the same amount of y, therefore:
3995 + 225.50 * x = 6500 + 100.25 * x
solved we have:
225.50 * x - 100.25 * x = 6500 - 3995
125.25 * x = 2505
x = 2505 / 125.25
x = 20
which means that when the amount of sugar transported is 20 tons, the price is the same
Find the critical value needed to construct a confidence interval of the given level with the given sample size. Round the answers to three decimal places.
Part 1 of 4
(a) For level 95% and sample size 7.
Part 2 of 4
(b) For level 98% and sample size 12.
Part 3 of 4
(c) For level 99% and sample size 27.
Part 4 of 4
(d) For level 98% and sample size 14.
Answer:
a) [tex] t_{\alpha/2}=\pm 2.447[/tex]
b) [tex] t_{\alpha/2}=\pm 2.718[/tex]
c) [tex] t_{\alpha/2}=\pm 2.779[/tex]
d) [tex] t_{\alpha/2}=\pm 2.650[/tex]
Step-by-step explanation:
Part a
The degrees of freedom are given by:
[tex] df=n-1= 7-1=6[/tex]
The confidence is 95% or 0.95 the significance would be [tex]\alpha=0.05[/tex] and the critical values would be:
[tex] t_{\alpha/2}=\pm 2.447[/tex]
Part b
The degrees of freedom are given by:
[tex] df=n-1=12-1=11[/tex]
The confidence is 98% or 0.98 the significance would be [tex]\alpha=0.02[/tex] and the critical values would be:
[tex] t_{\alpha/2}=\pm 2.718[/tex]
Part c
The degrees of freedom are given by:
[tex] df=n-1=27-1=26[/tex]
The confidence is 99% or 0.99 the significance would be [tex]\alpha=0.01[/tex] and the critical values would be:
[tex] t_{\alpha/2}=\pm 2.779[/tex]
Part d
The degrees of freedom are given by:
[tex] df=n-1=14-1=13[/tex]
The confidence is 98% or 0.98 the significance would be [tex]\alpha=0.02[/tex] and the critical values would be:
[tex] t_{\alpha/2}=\pm 2.650[/tex]
A value of a test statistic defines the upper bounds of a confidence interval, statistical significance in a test statistic is known as the crucial value.
critical value:For part a )
n = 7
Calculating the degrees of freedom [tex]= df = n - 1 = 7 - 1 = 6[/tex]
At [tex]95\%[/tex] the confidence level, the t:
[tex]\alpha = 1 - 95\% = 1 - 0.95 = 0.05\\\\\frac{\alpha}{ 2} = \frac{0.05}{ 2} = 0.025\\\\t_{\frac{\alpha}{ 2}}\\\\df = t_{0.025,6} = 2.447\\\\[/tex]
The critical value = 2.447
For part b )
n =12
Calculating the degrees of freedom[tex]= df = n - 1 = 12 - 1 = 11[/tex]
At [tex]98\%[/tex] the confidence level , the t:
[tex]\alpha = 1 - 98\% = 1 - 0.98 = 0.02\\\\\frac{\alpha}{ 2}= \frac{0.02}{ 2} = 0.01\\\\t_{\frac{\alpha}{ 2}}\\\\df = t_{0.01,11} =2.718\\\\[/tex]
The critical value =2.718
For part c )
n = 27
Calculating the degrees of freedom [tex]= df = n - 1 = 27 - 1 = 26[/tex]
At [tex]99\%[/tex] the confidence level, the t:
[tex]\alpha = 1 - 99\% = 1 - 0.99 = 0.01\\\\\frac{\alpha}{ 2} = \frac{0.01}{ 2} = 0.005\\\\t_{\frac{\alpha}{ 2}}\\\\df = t_{0.005,26}=2.779\\\\[/tex]
The critical value =2.779
For part d )
n = 14
Calculating the degrees of freedom [tex]= df = n - 1 = 14 - 1 = 13[/tex]
At [tex]98\%[/tex] the confidence level, the t:
[tex]\alpha = 1 - 98\% = 1 - 0.98 = 0.02\\\\\frac{\alpha}{ 2} = \frac{0.02}{ 2} = 0.01\\\\t_{\frac{\alpha}{ 2}} \\\\df = t_{0.01,13} =2.650[/tex]
The critical value =2.650
Find out more about the critical value here:
brainly.com/question/14508634
Simplify the expression to a polynomial in standard form: (x-1)(3x^2-5x-3) (x−1)(3x 2 −5x−3)
Answer: 3x^3 -8*x^2 + 8*x + 3
Step-by-step explanation:
The standard form for a plolynomial is:
a*x^n + b*x^(n-1) + c*x^(n - 2) ........
We have:
(x-1)(3x^2-5x-3)
this is equal to:
3*x^3 - 5*x^2 + 3*x - 3*x^2 +5*x + 3
where the thing that i did is distribute the multiplication
this is equal to:
3x^3 -8*x^2 + 8*x + 3
Solve the following equation algebraically:
4x2 = 100
a. +0.2
b. +5
C.
+12.5
+10
d.
Answer:
[tex]\boxed{\sf \ \ \ answer \ b. \ \ +5 \ \ \ }[/tex]
Step-by-step explanation:
Hello
let's assume that we are looking for x >=0
[tex]4x^2=100 <=> \dfrac{4x^2}{4}=x^2=\dfrac{100}{4}=25\\<=>\sqrt{x^2}=25\\<=> |x| = 5 <=> x = 5 \ or \ x=-5[/tex]
Let's assume that we are looking for x>=0
so the correct answer is 5
When you add two rational numbers, each number
can be written as a ?
why should i have different units for volume and base area Ex: volume = [tex]in^{3}[/tex] Base Area = [tex]in^{2}[/tex] pyramid ^^^
Answer:
Step-by-step explanation:
Volume has three parameters and is three dimensional, thus needing a unit in the third power
In difference,
Area is two-dimensional and has only 2 parameters, thus needing a unit only in the second power
Answer:
see below
Step-by-step explanation:
Area is found by multiplying two dimensions together ( l*w)
Volume is found by multiplying three dimensions together ( l*w*n)
Explain what is meant by the equation lim x → 8 f(x) = 9. If |x1 − 8| < |x2 − 8|, then |f(x1) − 9| < |f(x2) − 9|. The values of f(x) can be made as close to 8 as we like by taking x sufficiently close to 9. f(x) = 9 for all values of x. If |x1 − 8| < |x2 − 8|, then |f(x1) − 9|≤ |f(x2) − 9|. The values of f(x) can be made as close to 9 as we like by taking x sufficiently close to 8. Is it possible for this statement to be true and yet f(8) = 6?
Explain. Yes, the graph could have a hole at (8, 9) and be defined such that f(8) = 6. Yes, the graph could have a vertical asymptote at x = 8 and be defined such that f(8) = 6. No, if f(8) = 6, then lim x→8 f(x) = 6. No, if lim x→8 f(x) = 9, then f(8) = 9.
Complete Question
1 Explain what is meant by the equation lim x → 8 f(x) = 9.
A If |x1 − 8| < |x2 − 8|, then |f(x1) − 9| < |f(x2) − 9|.
B The values of f(x) can be made as close to 8 as we like by taking x sufficiently close to 9.
C f(x) = 9 for all values of x.
D If |x1 − 8| < |x2 − 8|, then |f(x1) − 9|≤ |f(x2) − 9|.
E The values of f(x) can be made as close to 9 as we like by taking x sufficiently close to 8.
2 Is it possible for this statement to be true and yet f(8) = 6? Explain.
A Yes, the graph could have a hole at (8, 9) and be defined such that f(8) =6.
B Yes, the graph could have a vertical asymptote at x = 8 and be defined such that f(8) = 6.
C No, if f(8) = 6, then lim x→8 f(x) = 6.
D No, if lim x→8 f(x) = 9, then f(8) = 9.
Answer:
1
The correct option is D
2
The correct option is A
Step-by-step explanation:
Generally a a limit function [tex]\lim_{n \to x } f(x) = L[/tex]
Tell us that as n tends toward x the values of f(x) tends towards L hence for the first question E is the correct option
Now looking at the second question
Yes it is possible for lim x → 8 f(x) = 9. to be true and f(8) = 6 this is because the graph defined by this limit equation can have a hole the point
(8, 9) and created in such a way that f(8) = 6
Calculus's basic idea of limits in mathematics describes how a function behaves when its input approaches a specific value. No, if f(8) = 6, then lim x → 8 f(x) = 6. The correct option is C.
The statement "lim x → 8 f(x) = 9" means that as x approaches 8, the limit of f(x) is equal to 9. This implies that the function f(x) gets arbitrarily close to 9 as x gets arbitrarily close to 8.
If f(8) = 6, it means that the function f(x) has a specific value of 6 at x = 8. This contradicts the idea that f(x) gets arbitrarily close to 9 as x approaches 8.
Therefore, if f(8) = 6, it is not possible for the statement "lim x → 8 f(x) = 9" to be true.
To know more about equation limits follow
https://brainly.com/question/34255916
#SPJ3
What is the radius of the circle whose equation is x2 + y2 = 9?
81
3
9
Answer:
3
Step-by-step explanation:
x^2 + y^2 = 9
The equation of a circle is
(x-h)^2 + (y-k)^2 = r^2
( h,k) is the center and r is the radius
x^2 + y^2 = 3^2
The radius is 3
Ashley works at an electronics store. She is paid 15% of the sales price of the items
she sells in addition to her $120 weekly salary. How can Ashley use the value of her
weekly sales total to calculate how much money she will earn that week?
Answer:
E(s) = 0.15s + 120
Step-by-step explanation:
She earns 15% of her weekly sales plus her $120 salary base.
Answer: Its the second option
Step-by-step explanation: I Promise its correct!
Which of the following measurements is the most precise?
A.A 15.5 foot tall tree
B.An 84-year-old man
C.A gas price of $2.359 per gallon
Answer:
C.)
Step-by-step explanation:
C.) Because it states the exact decimals rather than just stating about $2.36. Also, the other options were not specific. Hope this helps!
A clinical trial was conducted to test the effectiveness of a drug for treating insomnia in older subjects. Before treatment, 17 subjects had a mean wake time of 100.0 min. After treatment, the 17 subjects had a mean wake time of 90.3 min and a standard deviation of 21.8 min. Assume that the 17 sample values appear to be from a normally distributed population and construct a 99% confidence interval estimate of the mean wake time for a population with drug treatments. What does the result suggest about the mean wake time of 100.0 min before the treatment? Does the drug appear to be effective?
Answer:
Step-by-step explanation:
Confidence interval is written in the form,
(Sample mean - margin of error, sample mean + margin of error)
The sample mean, x is the point estimate for the population mean.
Margin of error = z × s/√n
Where
s = sample standard deviation = 21.8
n = number of samples = 17
From the information given, the population standard deviation is unknown and the sample size is small, hence, we would use the t distribution to find the z score
In order to use the t distribution, we would determine the degree of freedom, df for the sample.
df = n - 1 = 17 - 1 = 16
Since confidence level = 99% = 0.99, α = 1 - CL = 1 – 0.99 = 0.01
α/2 = 0.01/2 = 0.005
the area to the right of z0.005 is 0.005 and the area to the left of z0.005 is 1 - 0.005 = 0.995
Looking at the t distribution table,
z = 2.921
Margin of error = 2.921 × 21.8/√17
= 15.44
The confidence interval for the mean wake time for a population with drug treatments is
90.3 ± 15.44
The upper limit is 90.3 + 15.44 = 105.74 mins
The lower limit is 90.3 - 15.44 = 74.86 mins
The result suggests that the mean wake time might have really reduced since the values barely fall above 100 minutes as in before treatment with a high degree of confidence. Therefore, the drug is effective.
I WILL MARK BRAINLIEST!!! I NEED HELP!! MY PARENTS ARE IN THE HOSPITAL I HAVE NO ONE TO ASK FOR HELP!!! I HAVE TWO MINUTES LEFT!!! I AM FINISHING THIS COURSE TO MAKE THEM PROUD!!! SOMEONE HELP!!!
Answer:
D
Step-by-step explanation:
rewrite the following equation in logarithmic form and exponential form
Answer:The answer for the first one is log2(.25)=-2
The answer for the second one is 8^3=512
Step-by-step explanation:
What errors are shown here? Check all that apply.
-the arrows should be a length of 2
-the arrows should be a length of 6
-the arrows should be pointing in the positive direction
-the arrows should start at zero
-the arrows should point in the negative direction
Answer:
-The arrows should be a length of 6
-The arrows should point in the negative direction
-The arrows should start at zero
Step-by-step explanation:
Hope this helps!
Answer:
B
D
E
Step-by-step explanation:
You take a train away from Bangkok at 1:50 a.m. on Wednesday. You ride the train for 16 hours and 40 minutes, at which point you arrive in Vladivostok at 9:30 p.m. on Wednesday, local time. How does Vladivostok’s time zone relate to Bangkok’s time zone?
a.
Vladivostok is three hours ahead of Bangkok.
b.
Vladivostok is nine hours behind Bangkok.
c.
Vladivostok is fifteen hours behind Bangkok.
d.
Vladivostok is twenty-one hours ahead of Bangkok.
Answer:
a.
Vladivostok is three hours ahead of Bangkok.
Step-by-step explanation:
Time the train left Bangkok is 1:50am
It traveled for 16 hours 40 minutes.
If the train was to be in Bangkok.
The Time Will be 1+16 hours then 50+40 minutes
Which is 17 hours + 1 hour 30 minutes
Which is 18 hours and 30 minutes
And 18 hours = 6:00 pm
So if it was in Bangkok the time with be 6:30 pm
But in Vladivostok, it was 9:30 pm
It's clear that Vladivostok time is faster by 3 hours
Please answer this correctly
Answer:
11 5/8
Step-by-step explanation:
Simply the 5/8 to 16th
5/8 equals to 10/16
Then add the 16ths together
The divide it by 16
Then add the whole numbers
Then add of them together to get your answer
Answer:
Exact Form:
93 /8
Decimal Form:
11.625
Mixed Number Form:
11 5 /8
Step-by-step explanation:
If you add every side together:
3 3/16 + 2 5/8 + 3 3/16 + 2 5/8 = 93/8
It's quite easy, just add everything together ;)